C23H27FN6OS — CID 137041621
5-[5-[3-[1-(4-fluorophenyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-1H-pyridin-2-one (PubChem CID 137041621) has the molecular formula C23H27FN6OS and a molecular weight of 454.58 g/mol. Its IUPAC name is 5-[5-[3-[1-(4-fluorophenyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-1H-pyridin-2-one.
| Compound Name | 5-[5-[3-[1-(4-fluorophenyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 137041621 |
| Molecular Formula | C23H27FN6OS |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 5-[5-[3-[1-(4-fluorophenyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-1H-pyridin-2-one |
| SMILES | Cn1c(SCCCN2CC3CCN(c4ccc(F)cc4)C3C2)nnc1-c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C23H27FN6OS/c1-28-22(16-3-8-21(31)25-13-16)26-27-23(28)32-12-2-10-29-14-17-9-11-30(20(17)15-29)19-6-4-18(24)5-7-19/h3-8,13,17,20H,2,9-12,14-15H2,1H3,(H,25,31) |
| InChIKey | BQDVGVNUGZSYNV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 70.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|