C16H18ClN5OS — CID 170923521
2-[4-[5-(3-chloropropylsulfanyl)-4-methyl-1,2,4-triazol-3-yl]phenyl]-5-methyl-1H-pyrazol-3-one (PubChem CID 170923521) has the molecular formula C16H18ClN5OS and a molecular weight of 363.87 g/mol. Its IUPAC name is 2-[4-[5-(3-chloropropylsulfanyl)-4-methyl-1,2,4-triazol-3-yl]phenyl]-5-methyl-1H-pyrazol-3-one.
| Compound Name | 2-[4-[5-(3-chloropropylsulfanyl)-4-methyl-1,2,4-triazol-3-yl]phenyl]-5-methyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 170923521 |
| Molecular Formula | C16H18ClN5OS |
| Molecular Weight | 363.87 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 2-[4-[5-(3-chloropropylsulfanyl)-4-methyl-1,2,4-triazol-3-yl]phenyl]-5-methyl-1H-pyrazol-3-one |
| SMILES | Cc1cc(=O)n(-c2ccc(-c3nnc(SCCCCl)n3C)cc2)[nH]1 |
| InChI | InChI=1S/C16H18ClN5OS/c1-11-10-14(23)22(20-11)13-6-4-12(5-7-13)15-18-19-16(21(15)2)24-9-3-8-17/h4-7,10,20H,3,8-9H2,1-2H3 |
| InChIKey | CIOCDXUTNXUYHE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 68.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.87 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|