C13H13FN4S — CID 78764746
4-[[5-(4-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]butanenitrile (PubChem CID 78764746) has the molecular formula C13H13FN4S and a molecular weight of 276.34 g/mol. Its IUPAC name is 4-[[5-(4-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]butanenitrile.
| Compound Name | 4-[[5-(4-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]butanenitrile |
|---|---|
| PubChem CID | 78764746 |
| Molecular Formula | C13H13FN4S |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 4-[[5-(4-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]butanenitrile |
| SMILES | Cn1c(SCCCC#N)nnc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C13H13FN4S/c1-18-12(10-4-6-11(14)7-5-10)16-17-13(18)19-9-3-2-8-15/h4-7H,2-3,9H2,1H3 |
| InChIKey | SXILIHVPJUMCBZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|