C16H18FN5S — CID 87037569
3-(4-fluorophenyl)-4-methyl-5-[3-(1-methylpyrazol-4-yl)propylsulfanyl]-1,2,4-triazole (PubChem CID 87037569) has the molecular formula C16H18FN5S and a molecular weight of 331.42 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-4-methyl-5-[3-(1-methylpyrazol-4-yl)propylsulfanyl]-1,2,4-triazole.
| Compound Name | 3-(4-fluorophenyl)-4-methyl-5-[3-(1-methylpyrazol-4-yl)propylsulfanyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 87037569 |
| Molecular Formula | C16H18FN5S |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 3-(4-fluorophenyl)-4-methyl-5-[3-(1-methylpyrazol-4-yl)propylsulfanyl]-1,2,4-triazole |
| SMILES | Cn1cc(CCCSc2nnc(-c3ccc(F)cc3)n2C)cn1 |
| InChI | InChI=1S/C16H18FN5S/c1-21-11-12(10-18-21)4-3-9-23-16-20-19-15(22(16)2)13-5-7-14(17)8-6-13/h5-8,10-11H,3-4,9H2,1-2H3 |
| InChIKey | HSKMGFRMSDBZEA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|