C19H24ClN5OS — CID 78892705
3-(2-chlorophenyl)-4-(3-methoxypropyl)-5-[3-(1-methylpyrazol-4-yl)propylsulfanyl]-1,2,4-triazole (PubChem CID 78892705) has the molecular formula C19H24ClN5OS and a molecular weight of 405.96 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-4-(3-methoxypropyl)-5-[3-(1-methylpyrazol-4-yl)propylsulfanyl]-1,2,4-triazole.
| Compound Name | 3-(2-chlorophenyl)-4-(3-methoxypropyl)-5-[3-(1-methylpyrazol-4-yl)propylsulfanyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 78892705 |
| Molecular Formula | C19H24ClN5OS |
| Molecular Weight | 405.96 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 3-(2-chlorophenyl)-4-(3-methoxypropyl)-5-[3-(1-methylpyrazol-4-yl)propylsulfanyl]-1,2,4-triazole |
| SMILES | COCCCn1c(SCCCc2cnn(C)c2)nnc1-c1ccccc1Cl |
| InChI | InChI=1S/C19H24ClN5OS/c1-24-14-15(13-21-24)7-5-12-27-19-23-22-18(25(19)10-6-11-26-2)16-8-3-4-9-17(16)20/h3-4,8-9,13-14H,5-7,10-12H2,1-2H3 |
| InChIKey | LUZRSBUYOFLWFY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 57.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.96 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|