C19H18FN3OS2 — CID 8672142
4-[3-ethyl-5-(4-fluorophenyl)-6-methyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanylbutanenitrile (PubChem CID 8672142) has the molecular formula C19H18FN3OS2 and a molecular weight of 387.51 g/mol. Its IUPAC name is 4-[3-ethyl-5-(4-fluorophenyl)-6-methyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanylbutanenitrile.
| Compound Name | 4-[3-ethyl-5-(4-fluorophenyl)-6-methyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanylbutanenitrile |
|---|---|
| PubChem CID | 8672142 |
| Molecular Formula | C19H18FN3OS2 |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 4-[3-ethyl-5-(4-fluorophenyl)-6-methyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanylbutanenitrile |
| SMILES | CCn1c(SCCCC#N)nc2sc(C)c(-c3ccc(F)cc3)c2c1=O |
| InChI | InChI=1S/C19H18FN3OS2/c1-3-23-18(24)16-15(13-6-8-14(20)9-7-13)12(2)26-17(16)22-19(23)25-11-5-4-10-21/h6-9H,3-5,11H2,1-2H3 |
| InChIKey | URBLWHFESAGXQD-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|