C23H24Cl2N4O2S — CID 42742605
5-[[4-(3,4-dichlorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-1-morpholin-4-ylpentan-1-one (PubChem CID 42742605) has the molecular formula C23H24Cl2N4O2S and a molecular weight of 491.44 g/mol. Its IUPAC name is 5-[[4-(3,4-dichlorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-1-morpholin-4-ylpentan-1-one.
| Compound Name | 5-[[4-(3,4-dichlorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-1-morpholin-4-ylpentan-1-one |
|---|---|
| PubChem CID | 42742605 |
| Molecular Formula | C23H24Cl2N4O2S |
| Molecular Weight | 491.44 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | 5-[[4-(3,4-dichlorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-1-morpholin-4-ylpentan-1-one |
| SMILES | O=C(CCCCSc1nnc(-c2ccccc2)n1-c1ccc(Cl)c(Cl)c1)N1CCOCC1 |
| InChI | InChI=1S/C23H24Cl2N4O2S/c24-19-10-9-18(16-20(19)25)29-22(17-6-2-1-3-7-17)26-27-23(29)32-15-5-4-8-21(30)28-11-13-31-14-12-28/h1-3,6-7,9-10,16H,4-5,8,11-15H2 |
| InChIKey | WWXSAMLYIJPRRN-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.44 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|