C25H22Cl2N4OS — CID 42742644
4-[[4-(3,4-dichlorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methylphenyl)butanamide (PubChem CID 42742644) has the molecular formula C25H22Cl2N4OS and a molecular weight of 497.45 g/mol. Its IUPAC name is 4-[[4-(3,4-dichlorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methylphenyl)butanamide.
| Compound Name | 4-[[4-(3,4-dichlorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methylphenyl)butanamide |
|---|---|
| PubChem CID | 42742644 |
| Molecular Formula | C25H22Cl2N4OS |
| Molecular Weight | 497.45 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | 4-[[4-(3,4-dichlorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methylphenyl)butanamide |
| SMILES | Cc1ccc(NC(=O)CCCSc2nnc(-c3ccccc3)n2-c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C25H22Cl2N4OS/c1-17-9-11-19(12-10-17)28-23(32)8-5-15-33-25-30-29-24(18-6-3-2-4-7-18)31(25)20-13-14-21(26)22(27)16-20/h2-4,6-7,9-14,16H,5,8,15H2,1H3,(H,28,32) |
| InChIKey | SNMJJZFHAGQOQO-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.45 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|