C18H11Cl2N5OS2 — CID 135979062
(Z)-2-(1,3-benzothiazol-2-yl)-4-[(6,8-dichloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanyl]-3-hydroxypent-2-enenitrile (PubChem CID 135979062) has the molecular formula C18H11Cl2N5OS2 and a molecular weight of 448.36 g/mol. Its IUPAC name is (Z)-2-(1,3-benzothiazol-2-yl)-4-[(6,8-dichloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanyl]-3-hydroxypent-2-enenitrile.
| Compound Name | (Z)-2-(1,3-benzothiazol-2-yl)-4-[(6,8-dichloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanyl]-3-hydroxypent-2-enenitrile |
|---|---|
| PubChem CID | 135979062 |
| Molecular Formula | C18H11Cl2N5OS2 |
| Molecular Weight | 448.36 g/mol |
| Exact Mass | 446.98 |
| IUPAC Name | (Z)-2-(1,3-benzothiazol-2-yl)-4-[(6,8-dichloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanyl]-3-hydroxypent-2-enenitrile |
| SMILES | CC(Sc1nnc2c(Cl)cc(Cl)cn12)/C(O)=C(\C#N)c1nc2ccccc2s1 |
| InChI | InChI=1S/C18H11Cl2N5OS2/c1-9(27-18-24-23-16-12(20)6-10(19)8-25(16)18)15(26)11(7-21)17-22-13-4-2-3-5-14(13)28-17/h2-6,8-9,26H,1H3/b15-11- |
| InChIKey | NMXRWRQYPWRLMJ-PTNGSMBKSA-N |
| XLogP | 5.62 |
| TPSA | 87.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.36 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|