C21H18N2O3S2 — CID 136810451
(4S)-2-(1,3-benzothiazol-2-yl)-4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)-3-hydroxypent-2-enenitrile (PubChem CID 136810451) has the molecular formula C21H18N2O3S2 and a molecular weight of 410.52 g/mol. Its IUPAC name is (4S)-2-(1,3-benzothiazol-2-yl)-4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)-3-hydroxypent-2-enenitrile.
| Compound Name | (4S)-2-(1,3-benzothiazol-2-yl)-4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)-3-hydroxypent-2-enenitrile |
|---|---|
| PubChem CID | 136810451 |
| Molecular Formula | C21H18N2O3S2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | (4S)-2-(1,3-benzothiazol-2-yl)-4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)-3-hydroxypent-2-enenitrile |
| SMILES | C[C@H](Sc1ccc2c(c1)OCCCO2)C(O)=C(C#N)c1nc2ccccc2s1 |
| InChI | InChI=1S/C21H18N2O3S2/c1-13(27-14-7-8-17-18(11-14)26-10-4-9-25-17)20(24)15(12-22)21-23-16-5-2-3-6-19(16)28-21/h2-3,5-8,11,13,24H,4,9-10H2,1H3/t13-/m0/s1 |
| InChIKey | JQFAODABUYJUFN-ZDUSSCGKSA-N |
| XLogP | 5.43 |
| TPSA | 75.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|