C22H24N6O3S2 — CID 135881223
3-[5-[(Z)-4-(1,3-benzothiazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl]sulfanyl-4-(oxolan-2-ylmethyl)-1,2,4-triazol-3-yl]propanamide (PubChem CID 135881223) has the molecular formula C22H24N6O3S2 and a molecular weight of 484.61 g/mol. Its IUPAC name is 3-[5-[(Z)-4-(1,3-benzothiazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl]sulfanyl-4-(oxolan-2-ylmethyl)-1,2,4-triazol-3-yl]propanamide.
| Compound Name | 3-[5-[(Z)-4-(1,3-benzothiazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl]sulfanyl-4-(oxolan-2-ylmethyl)-1,2,4-triazol-3-yl]propanamide |
|---|---|
| PubChem CID | 135881223 |
| Molecular Formula | C22H24N6O3S2 |
| Molecular Weight | 484.61 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 3-[5-[(Z)-4-(1,3-benzothiazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl]sulfanyl-4-(oxolan-2-ylmethyl)-1,2,4-triazol-3-yl]propanamide |
| SMILES | CC(Sc1nnc(CCC(N)=O)n1CC1CCCO1)/C(O)=C(\C#N)c1nc2ccccc2s1 |
| InChI | InChI=1S/C22H24N6O3S2/c1-13(20(30)15(11-23)21-25-16-6-2-3-7-17(16)33-21)32-22-27-26-19(9-8-18(24)29)28(22)12-14-5-4-10-31-14/h2-3,6-7,13-14,30H,4-5,8-10,12H2,1H3,(H2,24,29)/b20-15- |
| InChIKey | WWWLFRNLRKNDNE-HKWRFOASSA-N |
| XLogP | 3.46 |
| TPSA | 139.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.61 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|