C17H18O2S — CID 112778503
7-(1-phenylethylsulfanyl)-3,4-dihydro-2H-1,5-benzodioxepine (PubChem CID 112778503) has the molecular formula C17H18O2S and a molecular weight of 286.40 g/mol. Its IUPAC name is 7-(1-phenylethylsulfanyl)-3,4-dihydro-2H-1,5-benzodioxepine.
| Compound Name | 7-(1-phenylethylsulfanyl)-3,4-dihydro-2H-1,5-benzodioxepine |
|---|---|
| PubChem CID | 112778503 |
| Molecular Formula | C17H18O2S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 7-(1-phenylethylsulfanyl)-3,4-dihydro-2H-1,5-benzodioxepine |
| SMILES | CC(Sc1ccc2c(c1)OCCCO2)c1ccccc1 |
| InChI | InChI=1S/C17H18O2S/c1-13(14-6-3-2-4-7-14)20-15-8-9-16-17(12-15)19-11-5-10-18-16/h2-4,6-9,12-13H,5,10-11H2,1H3 |
| InChIKey | UCKZOWFUQHEMLU-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |