C21H16N4O2S2 — CID 135869821
(4R)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]pent-2-enenitrile (PubChem CID 135869821) has the molecular formula C21H16N4O2S2 and a molecular weight of 420.52 g/mol. Its IUPAC name is (4R)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]pent-2-enenitrile.
| Compound Name | (4R)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]pent-2-enenitrile |
|---|---|
| PubChem CID | 135869821 |
| Molecular Formula | C21H16N4O2S2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | (4R)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]pent-2-enenitrile |
| SMILES | Cc1ccccc1-c1nnc(S[C@H](C)C(O)=C(C#N)c2nc3ccccc3s2)o1 |
| InChI | InChI=1S/C21H16N4O2S2/c1-12-7-3-4-8-14(12)19-24-25-21(27-19)28-13(2)18(26)15(11-22)20-23-16-9-5-6-10-17(16)29-20/h3-10,13,26H,1-2H3/t13-/m1/s1 |
| InChIKey | DGXBDBKTNKWMKW-CYBMUJFWSA-N |
| XLogP | 5.63 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|