C15H10ClN5O2S — CID 21239007
3-chloro-2-[(6-nitro-1H-benzimidazol-2-yl)sulfanylmethyl]imidazo[1,2-a]pyridine (PubChem CID 21239007) has the molecular formula C15H10ClN5O2S and a molecular weight of 359.80 g/mol. Its IUPAC name is 3-chloro-2-[(6-nitro-1H-benzimidazol-2-yl)sulfanylmethyl]imidazo[1,2-a]pyridine.
| Compound Name | 3-chloro-2-[(6-nitro-1H-benzimidazol-2-yl)sulfanylmethyl]imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 21239007 |
| Molecular Formula | C15H10ClN5O2S |
| Molecular Weight | 359.80 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | 3-chloro-2-[(6-nitro-1H-benzimidazol-2-yl)sulfanylmethyl]imidazo[1,2-a]pyridine |
| SMILES | O=[N+]([O-])c1ccc2nc(SCc3nc4ccccn4c3Cl)[nH]c2c1 |
| InChI | InChI=1S/C15H10ClN5O2S/c16-14-12(17-13-3-1-2-6-20(13)14)8-24-15-18-10-5-4-9(21(22)23)7-11(10)19-15/h1-7H,8H2,(H,18,19) |
| InChIKey | HWFGOUGBYUQQFQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.80 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|