C21H16N4O2S2 — CID 135922336
(Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[1-(3-methoxyphenyl)imidazol-2-yl]sulfanylbut-2-enenitrile (PubChem CID 135922336) has the molecular formula C21H16N4O2S2 and a molecular weight of 420.52 g/mol. Its IUPAC name is (Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[1-(3-methoxyphenyl)imidazol-2-yl]sulfanylbut-2-enenitrile.
| Compound Name | (Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[1-(3-methoxyphenyl)imidazol-2-yl]sulfanylbut-2-enenitrile |
|---|---|
| PubChem CID | 135922336 |
| Molecular Formula | C21H16N4O2S2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | (Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[1-(3-methoxyphenyl)imidazol-2-yl]sulfanylbut-2-enenitrile |
| SMILES | COc1cccc(-n2ccnc2SC/C(O)=C(\C#N)c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C21H16N4O2S2/c1-27-15-6-4-5-14(11-15)25-10-9-23-21(25)28-13-18(26)16(12-22)20-24-17-7-2-3-8-19(17)29-20/h2-11,26H,13H2,1H3/b18-16- |
| InChIKey | WUQSLSUXYYKABB-VLGSPTGOSA-N |
| XLogP | 5.08 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|