C12H10N4OS3 — CID 135851128
4-amino-2-[(2-sulfanylidene-1,3-benzothiazol-3-yl)methylsulfanyl]-1H-pyrimidin-6-one (PubChem CID 135851128) has the molecular formula C12H10N4OS3 and a molecular weight of 322.44 g/mol. Its IUPAC name is 4-amino-2-[(2-sulfanylidene-1,3-benzothiazol-3-yl)methylsulfanyl]-1H-pyrimidin-6-one.
| Compound Name | 4-amino-2-[(2-sulfanylidene-1,3-benzothiazol-3-yl)methylsulfanyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135851128 |
| Molecular Formula | C12H10N4OS3 |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | 4-amino-2-[(2-sulfanylidene-1,3-benzothiazol-3-yl)methylsulfanyl]-1H-pyrimidin-6-one |
| SMILES | Nc1cc(=O)[nH]c(SCn2c(=S)sc3ccccc32)n1 |
| InChI | InChI=1S/C12H10N4OS3/c13-9-5-10(17)15-11(14-9)19-6-16-7-3-1-2-4-8(7)20-12(16)18/h1-5H,6H2,(H3,13,14,15,17) |
| InChIKey | AGKKLDCUBRLRPN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 76.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|