C19H13BrN2O4S — CID 135466058
[(Z)-3-(1,3-benzothiazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-(4-bromophenoxy)acetate (PubChem CID 135466058) has the molecular formula C19H13BrN2O4S and a molecular weight of 445.29 g/mol. Its IUPAC name is [(Z)-3-(1,3-benzothiazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-(4-bromophenoxy)acetate.
| Compound Name | [(Z)-3-(1,3-benzothiazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-(4-bromophenoxy)acetate |
|---|---|
| PubChem CID | 135466058 |
| Molecular Formula | C19H13BrN2O4S |
| Molecular Weight | 445.29 g/mol |
| Exact Mass | 443.98 |
| IUPAC Name | [(Z)-3-(1,3-benzothiazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-(4-bromophenoxy)acetate |
| SMILES | N#C/C(=C(/O)COC(=O)COc1ccc(Br)cc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C19H13BrN2O4S/c20-12-5-7-13(8-6-12)25-11-18(24)26-10-16(23)14(9-21)19-22-15-3-1-2-4-17(15)27-19/h1-8,23H,10-11H2/b16-14- |
| InChIKey | FUFFXYHLSSJWEX-PEZBUJJGSA-N |
| XLogP | 4.47 |
| TPSA | 92.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.29 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|