C22H14N2O4S — CID 135535970
[(Z)-3-(1,3-benzothiazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 3-hydroxynaphthalene-2-carboxylate (PubChem CID 135535970) has the molecular formula C22H14N2O4S and a molecular weight of 402.43 g/mol. Its IUPAC name is [(Z)-3-(1,3-benzothiazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 3-hydroxynaphthalene-2-carboxylate.
| Compound Name | [(Z)-3-(1,3-benzothiazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 3-hydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 135535970 |
| Molecular Formula | C22H14N2O4S |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | [(Z)-3-(1,3-benzothiazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 3-hydroxynaphthalene-2-carboxylate |
| SMILES | N#C/C(=C(/O)COC(=O)c1cc2ccccc2cc1O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C22H14N2O4S/c23-11-16(21-24-17-7-3-4-8-20(17)29-21)19(26)12-28-22(27)15-9-13-5-1-2-6-14(13)10-18(15)25/h1-10,25-26H,12H2/b19-16- |
| InChIKey | SZPNTFSICMFRMG-MNDPQUGUSA-N |
| XLogP | 4.80 |
| TPSA | 103.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|