C18H12BrN3O4 — CID 2365241
[3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 5-bromo-2-hydroxybenzoate (PubChem CID 2365241) has the molecular formula C18H12BrN3O4 and a molecular weight of 414.22 g/mol. Its IUPAC name is [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 5-bromo-2-hydroxybenzoate.
| Compound Name | [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 5-bromo-2-hydroxybenzoate |
|---|---|
| PubChem CID | 2365241 |
| Molecular Formula | C18H12BrN3O4 |
| Molecular Weight | 414.22 g/mol |
| Exact Mass | 413.00 |
| IUPAC Name | [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 5-bromo-2-hydroxybenzoate |
| SMILES | N#CC(=C(O)COC(=O)c1cc(Br)ccc1O)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C18H12BrN3O4/c19-10-5-6-15(23)11(7-10)18(25)26-9-16(24)12(8-20)17-21-13-3-1-2-4-14(13)22-17/h1-7,23-24H,9H2,(H,21,22) |
| InChIKey | LMPZCWZCJODSDR-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.22 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|