C25H15ClN4O3S — CID 2400006
[3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-(5-chlorothiophen-2-yl)quinoline-4-carboxylate (PubChem CID 2400006) has the molecular formula C25H15ClN4O3S and a molecular weight of 486.94 g/mol. Its IUPAC name is [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-(5-chlorothiophen-2-yl)quinoline-4-carboxylate.
| Compound Name | [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-(5-chlorothiophen-2-yl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 2400006 |
| Molecular Formula | C25H15ClN4O3S |
| Molecular Weight | 486.94 g/mol |
| Exact Mass | 486.06 |
| IUPAC Name | [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-(5-chlorothiophen-2-yl)quinoline-4-carboxylate |
| SMILES | N#CC(=C(O)COC(=O)c1cc(-c2ccc(Cl)s2)nc2ccccc12)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C25H15ClN4O3S/c26-23-10-9-22(34-23)20-11-15(14-5-1-2-6-17(14)28-20)25(32)33-13-21(31)16(12-27)24-29-18-7-3-4-8-19(18)30-24/h1-11,31H,13H2,(H,29,30) |
| InChIKey | VJYSPWJPNKTQTL-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.94 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|