C20H16ClN3O5 — CID 135591626
[(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 3-chloro-4,5-dimethoxybenzoate (PubChem CID 135591626) has the molecular formula C20H16ClN3O5 and a molecular weight of 413.82 g/mol. Its IUPAC name is [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 3-chloro-4,5-dimethoxybenzoate.
| Compound Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 3-chloro-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 135591626 |
| Molecular Formula | C20H16ClN3O5 |
| Molecular Weight | 413.82 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 3-chloro-4,5-dimethoxybenzoate |
| SMILES | COc1cc(C(=O)OC/C(O)=C(\C#N)c2nc3ccccc3[nH]2)cc(Cl)c1OC |
| InChI | InChI=1S/C20H16ClN3O5/c1-27-17-8-11(7-13(21)18(17)28-2)20(26)29-10-16(25)12(9-22)19-23-14-5-3-4-6-15(14)24-19/h3-8,25H,10H2,1-2H3,(H,23,24)/b16-12- |
| InChIKey | FTZTXPAVYQNODR-VBKFSLOCSA-N |
| XLogP | 3.88 |
| TPSA | 117.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.82 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|