C22H19N3O6 — CID 4299582
[3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-(4-acetyl-2-methoxyphenoxy)acetate (PubChem CID 4299582) has the molecular formula C22H19N3O6 and a molecular weight of 421.41 g/mol. Its IUPAC name is [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-(4-acetyl-2-methoxyphenoxy)acetate.
| Compound Name | [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-(4-acetyl-2-methoxyphenoxy)acetate |
|---|---|
| PubChem CID | 4299582 |
| Molecular Formula | C22H19N3O6 |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-(4-acetyl-2-methoxyphenoxy)acetate |
| SMILES | COc1cc(C(C)=O)ccc1OCC(=O)OCC(O)=C(C#N)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C22H19N3O6/c1-13(26)14-7-8-19(20(9-14)29-2)30-12-21(28)31-11-18(27)15(10-23)22-24-16-5-3-4-6-17(16)25-22/h3-9,27H,11-12H2,1-2H3,(H,24,25) |
| InChIKey | HHEIHMKUNISMHD-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 134.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|