C23H16Cl2N4O4 — CID 3454388
[3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetate (PubChem CID 3454388) has the molecular formula C23H16Cl2N4O4 and a molecular weight of 483.31 g/mol. Its IUPAC name is [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetate.
| Compound Name | [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetate |
|---|---|
| PubChem CID | 3454388 |
| Molecular Formula | C23H16Cl2N4O4 |
| Molecular Weight | 483.31 g/mol |
| Exact Mass | 482.05 |
| IUPAC Name | [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetate |
| SMILES | Cc1ccc2c(Cl)cc(Cl)c(OCC(=O)OCC(O)=C(C#N)c3nc4ccccc4[nH]3)c2n1 |
| InChI | InChI=1S/C23H16Cl2N4O4/c1-12-6-7-13-15(24)8-16(25)22(21(13)27-12)33-11-20(31)32-10-19(30)14(9-26)23-28-17-4-2-3-5-18(17)29-23/h2-8,30H,10-11H2,1H3,(H,28,29) |
| InChIKey | GFXWYOGPWPIATJ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 121.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.31 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|