C21H13Cl2N3O2S — CID 135591912
(Z)-2-(1,3-benzothiazol-2-yl)-4-(5,7-dichloro-2-methylquinolin-8-yl)oxy-3-hydroxybut-2-enenitrile (PubChem CID 135591912) has the molecular formula C21H13Cl2N3O2S and a molecular weight of 442.33 g/mol. Its IUPAC name is (Z)-2-(1,3-benzothiazol-2-yl)-4-(5,7-dichloro-2-methylquinolin-8-yl)oxy-3-hydroxybut-2-enenitrile.
| Compound Name | (Z)-2-(1,3-benzothiazol-2-yl)-4-(5,7-dichloro-2-methylquinolin-8-yl)oxy-3-hydroxybut-2-enenitrile |
|---|---|
| PubChem CID | 135591912 |
| Molecular Formula | C21H13Cl2N3O2S |
| Molecular Weight | 442.33 g/mol |
| Exact Mass | 441.01 |
| IUPAC Name | (Z)-2-(1,3-benzothiazol-2-yl)-4-(5,7-dichloro-2-methylquinolin-8-yl)oxy-3-hydroxybut-2-enenitrile |
| SMILES | Cc1ccc2c(Cl)cc(Cl)c(OC/C(O)=C(\C#N)c3nc4ccccc4s3)c2n1 |
| InChI | InChI=1S/C21H13Cl2N3O2S/c1-11-6-7-12-14(22)8-15(23)20(19(12)25-11)28-10-17(27)13(9-24)21-26-16-4-2-3-5-18(16)29-21/h2-8,27H,10H2,1H3/b17-13- |
| InChIKey | FUKLQEOZDFTEEB-LGMDPLHJSA-N |
| XLogP | 6.33 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.33 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|