C20H14Cl2N2O3 — CID 8887751
(2-cyanophenyl)methyl 2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetate (PubChem CID 8887751) has the molecular formula C20H14Cl2N2O3 and a molecular weight of 401.25 g/mol. Its IUPAC name is (2-cyanophenyl)methyl 2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetate.
| Compound Name | (2-cyanophenyl)methyl 2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetate |
|---|---|
| PubChem CID | 8887751 |
| Molecular Formula | C20H14Cl2N2O3 |
| Molecular Weight | 401.25 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | (2-cyanophenyl)methyl 2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetate |
| SMILES | Cc1ccc2c(Cl)cc(Cl)c(OCC(=O)OCc3ccccc3C#N)c2n1 |
| InChI | InChI=1S/C20H14Cl2N2O3/c1-12-6-7-15-16(21)8-17(22)20(19(15)24-12)27-11-18(25)26-10-14-5-3-2-4-13(14)9-23/h2-8H,10-11H2,1H3 |
| InChIKey | NVEVDGVJFNCFLX-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 72.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.25 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |