C20H14Cl2FN3O6 — CID 2667528
[2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetate (PubChem CID 2667528) has the molecular formula C20H14Cl2FN3O6 and a molecular weight of 482.25 g/mol. Its IUPAC name is [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetate.
| Compound Name | [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetate |
|---|---|
| PubChem CID | 2667528 |
| Molecular Formula | C20H14Cl2FN3O6 |
| Molecular Weight | 482.25 g/mol |
| Exact Mass | 481.02 |
| IUPAC Name | [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetate |
| SMILES | Cc1ccc2c(Cl)cc(Cl)c(OCC(=O)OCC(=O)Nc3cc([N+](=O)[O-])ccc3F)c2n1 |
| InChI | InChI=1S/C20H14Cl2FN3O6/c1-10-2-4-12-13(21)7-14(22)20(19(12)24-10)32-9-18(28)31-8-17(27)25-16-6-11(26(29)30)3-5-15(16)23/h2-7H,8-9H2,1H3,(H,25,27) |
| InChIKey | LKQDKSJUAVLNGB-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.25 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|