C24H14Cl2FN3O5S2 — CID 137285826
[(E)-3-(1,3-benzothiazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2,4-dichloro-5-[(4-fluorophenyl)sulfamoyl]benzoate (PubChem CID 137285826) has the molecular formula C24H14Cl2FN3O5S2 and a molecular weight of 578.43 g/mol. Its IUPAC name is [(E)-3-(1,3-benzothiazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2,4-dichloro-5-[(4-fluorophenyl)sulfamoyl]benzoate.
| Compound Name | [(E)-3-(1,3-benzothiazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2,4-dichloro-5-[(4-fluorophenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 137285826 |
| Molecular Formula | C24H14Cl2FN3O5S2 |
| Molecular Weight | 578.43 g/mol |
| Exact Mass | 576.97 |
| IUPAC Name | [(E)-3-(1,3-benzothiazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2,4-dichloro-5-[(4-fluorophenyl)sulfamoyl]benzoate |
| SMILES | N#C/C(=C(\O)COC(=O)c1cc(S(=O)(=O)Nc2ccc(F)cc2)c(Cl)cc1Cl)c1nc2ccccc2s1 |
| InChI | InChI=1S/C24H14Cl2FN3O5S2/c25-17-10-18(26)22(37(33,34)30-14-7-5-13(27)6-8-14)9-15(17)24(32)35-12-20(31)16(11-28)23-29-19-3-1-2-4-21(19)36-23/h1-10,30-31H,12H2/b20-16+ |
| InChIKey | HRGSOSPIYRSLME-CAPFRKAQSA-N |
| XLogP | 6.19 |
| TPSA | 129.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.43 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|