C27H17Cl2FN2O5S2 — CID 25038882
(2-oxo-2-phenothiazin-10-ylethyl) 2,4-dichloro-5-[(4-fluorophenyl)sulfamoyl]benzoate (PubChem CID 25038882) has the molecular formula C27H17Cl2FN2O5S2 and a molecular weight of 603.48 g/mol. Its IUPAC name is (2-oxo-2-phenothiazin-10-ylethyl) 2,4-dichloro-5-[(4-fluorophenyl)sulfamoyl]benzoate.
| Compound Name | (2-oxo-2-phenothiazin-10-ylethyl) 2,4-dichloro-5-[(4-fluorophenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 25038882 |
| Molecular Formula | C27H17Cl2FN2O5S2 |
| Molecular Weight | 603.48 g/mol |
| Exact Mass | 601.99 |
| IUPAC Name | (2-oxo-2-phenothiazin-10-ylethyl) 2,4-dichloro-5-[(4-fluorophenyl)sulfamoyl]benzoate |
| SMILES | O=C(OCC(=O)N1c2ccccc2Sc2ccccc21)c1cc(S(=O)(=O)Nc2ccc(F)cc2)c(Cl)cc1Cl |
| InChI | InChI=1S/C27H17Cl2FN2O5S2/c28-19-14-20(29)25(39(35,36)31-17-11-9-16(30)10-12-17)13-18(19)27(34)37-15-26(33)32-21-5-1-3-7-23(21)38-24-8-4-2-6-22(24)32/h1-14,31H,15H2 |
| InChIKey | TXLWPPUCFOMXBW-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.48 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |