C21H13Cl3FN3O7S — CID 25042540
[2-(2-chloro-5-nitroanilino)-2-oxoethyl] 2,4-dichloro-5-[(4-fluorophenyl)sulfamoyl]benzoate (PubChem CID 25042540) has the molecular formula C21H13Cl3FN3O7S and a molecular weight of 576.77 g/mol. Its IUPAC name is [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 2,4-dichloro-5-[(4-fluorophenyl)sulfamoyl]benzoate.
| Compound Name | [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 2,4-dichloro-5-[(4-fluorophenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 25042540 |
| Molecular Formula | C21H13Cl3FN3O7S |
| Molecular Weight | 576.77 g/mol |
| Exact Mass | 574.95 |
| IUPAC Name | [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 2,4-dichloro-5-[(4-fluorophenyl)sulfamoyl]benzoate |
| SMILES | O=C(COC(=O)c1cc(S(=O)(=O)Nc2ccc(F)cc2)c(Cl)cc1Cl)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C21H13Cl3FN3O7S/c22-15-6-5-13(28(31)32)7-18(15)26-20(29)10-35-21(30)14-8-19(17(24)9-16(14)23)36(33,34)27-12-3-1-11(25)2-4-12/h1-9,27H,10H2,(H,26,29) |
| InChIKey | GLSKSVDQXXAKAW-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 144.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.77 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|