C22H17ClN2O3S — CID 28572191
ethyl 2-chloro-4-(phenothiazine-10-carbonylamino)benzoate (PubChem CID 28572191) has the molecular formula C22H17ClN2O3S and a molecular weight of 424.91 g/mol. Its IUPAC name is ethyl 2-chloro-4-(phenothiazine-10-carbonylamino)benzoate.
| Compound Name | ethyl 2-chloro-4-(phenothiazine-10-carbonylamino)benzoate |
|---|---|
| PubChem CID | 28572191 |
| Molecular Formula | C22H17ClN2O3S |
| Molecular Weight | 424.91 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | ethyl 2-chloro-4-(phenothiazine-10-carbonylamino)benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)N2c3ccccc3Sc3ccccc32)cc1Cl |
| InChI | InChI=1S/C22H17ClN2O3S/c1-2-28-21(26)15-12-11-14(13-16(15)23)24-22(27)25-17-7-3-5-9-19(17)29-20-10-6-4-8-18(20)25/h3-13H,2H2,1H3,(H,24,27) |
| InChIKey | JOZJKBKBUGAYFY-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.91 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |