C26H16N4O5 — CID 137295295
[(E)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 4-(1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 137295295) has the molecular formula C26H16N4O5 and a molecular weight of 464.44 g/mol. Its IUPAC name is [(E)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 4-(1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | [(E)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 4-(1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 137295295 |
| Molecular Formula | C26H16N4O5 |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | [(E)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 4-(1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | N#C/C(=C(\O)COC(=O)c1ccc(N2C(=O)c3ccccc3C2=O)cc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C26H16N4O5/c27-13-19(23-28-20-7-3-4-8-21(20)29-23)22(31)14-35-26(34)15-9-11-16(12-10-15)30-24(32)17-5-1-2-6-18(17)25(30)33/h1-12,31H,14H2,(H,28,29)/b22-19+ |
| InChIKey | PLPWMCYHCRLGRD-ZBJSNUHESA-N |
| XLogP | 4.01 |
| TPSA | 136.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|