C27H20N4O2S — CID 135599332
(Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-(7-methoxy-4-phenylquinolin-2-yl)sulfanylbut-2-enenitrile (PubChem CID 135599332) has the molecular formula C27H20N4O2S and a molecular weight of 464.55 g/mol. Its IUPAC name is (Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-(7-methoxy-4-phenylquinolin-2-yl)sulfanylbut-2-enenitrile.
| Compound Name | (Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-(7-methoxy-4-phenylquinolin-2-yl)sulfanylbut-2-enenitrile |
|---|---|
| PubChem CID | 135599332 |
| Molecular Formula | C27H20N4O2S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | (Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-(7-methoxy-4-phenylquinolin-2-yl)sulfanylbut-2-enenitrile |
| SMILES | COc1ccc2c(-c3ccccc3)cc(SC/C(O)=C(\C#N)c3nc4ccccc4[nH]3)nc2c1 |
| InChI | InChI=1S/C27H20N4O2S/c1-33-18-11-12-19-20(17-7-3-2-4-8-17)14-26(29-24(19)13-18)34-16-25(32)21(15-28)27-30-22-9-5-6-10-23(22)31-27/h2-14,32H,16H2,1H3,(H,30,31)/b25-21- |
| InChIKey | UEHGZVMJOZYJRG-DAFNUICNSA-N |
| XLogP | 6.37 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|