C22H19N3O2S — CID 7246005
2-ethanimidoyl-4-(7-methoxy-4-phenylquinolin-2-yl)sulfanyl-3-oxobutanenitrile (PubChem CID 7246005) has the molecular formula C22H19N3O2S and a molecular weight of 389.48 g/mol. Its IUPAC name is 2-ethanimidoyl-4-(7-methoxy-4-phenylquinolin-2-yl)sulfanyl-3-oxobutanenitrile.
| Compound Name | 2-ethanimidoyl-4-(7-methoxy-4-phenylquinolin-2-yl)sulfanyl-3-oxobutanenitrile |
|---|---|
| PubChem CID | 7246005 |
| Molecular Formula | C22H19N3O2S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 2-ethanimidoyl-4-(7-methoxy-4-phenylquinolin-2-yl)sulfanyl-3-oxobutanenitrile |
| SMILES | [H]/N=C(\C)C(C#N)C(=O)CSc1cc(-c2ccccc2)c2ccc(OC)cc2n1 |
| InChI | InChI=1S/C22H19N3O2S/c1-14(24)19(12-23)21(26)13-28-22-11-18(15-6-4-3-5-7-15)17-9-8-16(27-2)10-20(17)25-22/h3-11,19,24H,13H2,1-2H3/b24-14+ |
| InChIKey | QYVXJNLQPVQSCC-ZVHZXABRSA-N |
| XLogP | 4.75 |
| TPSA | 86.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|