C26H25N5O2S — CID 17402158
2-(7-methoxy-4-phenylquinolin-2-yl)sulfanyl-1-(4-pyrimidin-2-ylpiperazin-1-yl)ethanone (PubChem CID 17402158) has the molecular formula C26H25N5O2S and a molecular weight of 471.59 g/mol. Its IUPAC name is 2-(7-methoxy-4-phenylquinolin-2-yl)sulfanyl-1-(4-pyrimidin-2-ylpiperazin-1-yl)ethanone.
| Compound Name | 2-(7-methoxy-4-phenylquinolin-2-yl)sulfanyl-1-(4-pyrimidin-2-ylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 17402158 |
| Molecular Formula | C26H25N5O2S |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 2-(7-methoxy-4-phenylquinolin-2-yl)sulfanyl-1-(4-pyrimidin-2-ylpiperazin-1-yl)ethanone |
| SMILES | COc1ccc2c(-c3ccccc3)cc(SCC(=O)N3CCN(c4ncccn4)CC3)nc2c1 |
| InChI | InChI=1S/C26H25N5O2S/c1-33-20-8-9-21-22(19-6-3-2-4-7-19)17-24(29-23(21)16-20)34-18-25(32)30-12-14-31(15-13-30)26-27-10-5-11-28-26/h2-11,16-17H,12-15,18H2,1H3 |
| InChIKey | JMTLYTOWNVVLFL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 71.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |