C22H22N2O4S2 — CID 4876405
N-(1,1-dioxothiolan-3-yl)-2-(7-methoxy-4-phenylquinolin-2-yl)sulfanylacetamide (PubChem CID 4876405) has the molecular formula C22H22N2O4S2 and a molecular weight of 442.56 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-(7-methoxy-4-phenylquinolin-2-yl)sulfanylacetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-(7-methoxy-4-phenylquinolin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 4876405 |
| Molecular Formula | C22H22N2O4S2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-(7-methoxy-4-phenylquinolin-2-yl)sulfanylacetamide |
| SMILES | COc1ccc2c(-c3ccccc3)cc(SCC(=O)NC3CCS(=O)(=O)C3)nc2c1 |
| InChI | InChI=1S/C22H22N2O4S2/c1-28-17-7-8-18-19(15-5-3-2-4-6-15)12-22(24-20(18)11-17)29-13-21(25)23-16-9-10-30(26,27)14-16/h2-8,11-12,16H,9-10,13-14H2,1H3,(H,23,25) |
| InChIKey | SPYIOZHCWFVASR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |