C15H16N2O3S2 — CID 40551032
N-[(3R)-1,1-dioxothiolan-3-yl]-2-quinolin-2-ylsulfanylacetamide (PubChem CID 40551032) has the molecular formula C15H16N2O3S2 and a molecular weight of 336.44 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-2-quinolin-2-ylsulfanylacetamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-2-quinolin-2-ylsulfanylacetamide |
|---|---|
| PubChem CID | 40551032 |
| Molecular Formula | C15H16N2O3S2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-2-quinolin-2-ylsulfanylacetamide |
| SMILES | O=C(CSc1ccc2ccccc2n1)N[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H16N2O3S2/c18-14(16-12-7-8-22(19,20)10-12)9-21-15-6-5-11-3-1-2-4-13(11)17-15/h1-6,12H,7-10H2,(H,16,18)/t12-/m1/s1 |
| InChIKey | FKFWIQLUKGXJGG-GFCCVEGCSA-N |
| XLogP | 1.63 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |