C18H23N5O2 — CID 135809797
2-[[(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl]-methylamino]-N-tert-butylacetamide (PubChem CID 135809797) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is 2-[[(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl]-methylamino]-N-tert-butylacetamide.
| Compound Name | 2-[[(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl]-methylamino]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 135809797 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 2-[[(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl]-methylamino]-N-tert-butylacetamide |
| SMILES | CN(CC(=O)NC(C)(C)C)C/C(O)=C(\C#N)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C18H23N5O2/c1-18(2,3)22-16(25)11-23(4)10-15(24)12(9-19)17-20-13-7-5-6-8-14(13)21-17/h5-8,24H,10-11H2,1-4H3,(H,20,21)(H,22,25)/b15-12- |
| InChIKey | QLQQADWHTDEQMK-QINSGFPZSA-N |
| XLogP | 2.20 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|