C17H11ClFN3O2 — CID 135788770
(Z)-2-(1H-benzimidazol-2-yl)-4-(2-chloro-4-fluorophenoxy)-3-hydroxybut-2-enenitrile (PubChem CID 135788770) has the molecular formula C17H11ClFN3O2 and a molecular weight of 343.75 g/mol. Its IUPAC name is (Z)-2-(1H-benzimidazol-2-yl)-4-(2-chloro-4-fluorophenoxy)-3-hydroxybut-2-enenitrile.
| Compound Name | (Z)-2-(1H-benzimidazol-2-yl)-4-(2-chloro-4-fluorophenoxy)-3-hydroxybut-2-enenitrile |
|---|---|
| PubChem CID | 135788770 |
| Molecular Formula | C17H11ClFN3O2 |
| Molecular Weight | 343.75 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | (Z)-2-(1H-benzimidazol-2-yl)-4-(2-chloro-4-fluorophenoxy)-3-hydroxybut-2-enenitrile |
| SMILES | N#C/C(=C(/O)COc1ccc(F)cc1Cl)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C17H11ClFN3O2/c18-12-7-10(19)5-6-16(12)24-9-15(23)11(8-20)17-21-13-3-1-2-4-14(13)22-17/h1-7,23H,9H2,(H,21,22)/b15-11- |
| InChIKey | UNHVOARNUKPAIY-PTNGSMBKSA-N |
| XLogP | 4.23 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.75 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|