C19H12Cl2N6OS — CID 135796450
(Z)-2-(1H-benzimidazol-2-yl)-4-[[5-(2,5-dichlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enenitrile (PubChem CID 135796450) has the molecular formula C19H12Cl2N6OS and a molecular weight of 443.32 g/mol. Its IUPAC name is (Z)-2-(1H-benzimidazol-2-yl)-4-[[5-(2,5-dichlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enenitrile.
| Compound Name | (Z)-2-(1H-benzimidazol-2-yl)-4-[[5-(2,5-dichlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enenitrile |
|---|---|
| PubChem CID | 135796450 |
| Molecular Formula | C19H12Cl2N6OS |
| Molecular Weight | 443.32 g/mol |
| Exact Mass | 442.02 |
| IUPAC Name | (Z)-2-(1H-benzimidazol-2-yl)-4-[[5-(2,5-dichlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enenitrile |
| SMILES | N#C/C(=C(/O)CSc1n[nH]c(-c2cc(Cl)ccc2Cl)n1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H12Cl2N6OS/c20-10-5-6-13(21)11(7-10)18-25-19(27-26-18)29-9-16(28)12(8-22)17-23-14-3-1-2-4-15(14)24-17/h1-7,28H,9H2,(H,23,24)(H,25,26,27)/b16-12- |
| InChIKey | ABSVPYSEXDPVMM-VBKFSLOCSA-N |
| XLogP | 5.24 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.32 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|