C22H19N5OS2 — CID 4544358
2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[(2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]but-2-enenitrile (PubChem CID 4544358) has the molecular formula C22H19N5OS2 and a molecular weight of 433.56 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[(2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]but-2-enenitrile.
| Compound Name | 2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[(2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]but-2-enenitrile |
|---|---|
| PubChem CID | 4544358 |
| Molecular Formula | C22H19N5OS2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[(2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]but-2-enenitrile |
| SMILES | Cc1nc(SCC(O)=C(C#N)c2nc3ccccc3[nH]2)c2c3c(sc2n1)CCCC3 |
| InChI | InChI=1S/C22H19N5OS2/c1-12-24-21(19-13-6-2-5-9-18(13)30-22(19)25-12)29-11-17(28)14(10-23)20-26-15-7-3-4-8-16(15)27-20/h3-4,7-8,28H,2,5-6,9,11H2,1H3,(H,26,27) |
| InChIKey | ILFBXDCBBLVRNB-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|