C22H21N5O4S2 — CID 135925538
methyl (E)-2-(1H-benzimidazol-2-yl)-4-[[5-(2-ethoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-3-hydroxybut-2-enoate (PubChem CID 135925538) has the molecular formula C22H21N5O4S2 and a molecular weight of 483.58 g/mol. Its IUPAC name is methyl (E)-2-(1H-benzimidazol-2-yl)-4-[[5-(2-ethoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-3-hydroxybut-2-enoate.
| Compound Name | methyl (E)-2-(1H-benzimidazol-2-yl)-4-[[5-(2-ethoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 135925538 |
| Molecular Formula | C22H21N5O4S2 |
| Molecular Weight | 483.58 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | methyl (E)-2-(1H-benzimidazol-2-yl)-4-[[5-(2-ethoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-3-hydroxybut-2-enoate |
| SMILES | CCOc1ccccc1Nc1nnc(SC/C(O)=C(\C(=O)OC)c2nc3ccccc3[nH]2)s1 |
| InChI | InChI=1S/C22H21N5O4S2/c1-3-31-17-11-7-6-10-15(17)25-21-26-27-22(33-21)32-12-16(28)18(20(29)30-2)19-23-13-8-4-5-9-14(13)24-19/h4-11,28H,3,12H2,1-2H3,(H,23,24)(H,25,26)/b18-16+ |
| InChIKey | FDSLHAOAVBNZPR-FBMGVBCBSA-N |
| XLogP | 4.79 |
| TPSA | 122.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.58 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|