C21H18N6O2S2 — CID 4636975
2-(1H-benzimidazol-2-yl)-4-[[5-(2-ethoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-3-hydroxybut-2-enenitrile (PubChem CID 4636975) has the molecular formula C21H18N6O2S2 and a molecular weight of 450.55 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-4-[[5-(2-ethoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-3-hydroxybut-2-enenitrile.
| Compound Name | 2-(1H-benzimidazol-2-yl)-4-[[5-(2-ethoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-3-hydroxybut-2-enenitrile |
|---|---|
| PubChem CID | 4636975 |
| Molecular Formula | C21H18N6O2S2 |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-4-[[5-(2-ethoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-3-hydroxybut-2-enenitrile |
| SMILES | CCOc1ccccc1Nc1nnc(SCC(O)=C(C#N)c2nc3ccccc3[nH]2)s1 |
| InChI | InChI=1S/C21H18N6O2S2/c1-2-29-18-10-6-5-9-16(18)25-20-26-27-21(31-20)30-12-17(28)13(11-22)19-23-14-7-3-4-8-15(14)24-19/h3-10,28H,2,12H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | KZSMTXVKDQEMSB-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 119.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|