C20H16ClN5O3S — CID 135925556
methyl (E)-2-(1H-benzimidazol-2-yl)-4-[[4-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enoate (PubChem CID 135925556) has the molecular formula C20H16ClN5O3S and a molecular weight of 441.90 g/mol. Its IUPAC name is methyl (E)-2-(1H-benzimidazol-2-yl)-4-[[4-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enoate.
| Compound Name | methyl (E)-2-(1H-benzimidazol-2-yl)-4-[[4-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 135925556 |
| Molecular Formula | C20H16ClN5O3S |
| Molecular Weight | 441.90 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | methyl (E)-2-(1H-benzimidazol-2-yl)-4-[[4-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enoate |
| SMILES | COC(=O)/C(=C(/O)CSc1nncn1-c1cccc(Cl)c1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H16ClN5O3S/c1-29-19(28)17(18-23-14-7-2-3-8-15(14)24-18)16(27)10-30-20-25-22-11-26(20)13-6-4-5-12(21)9-13/h2-9,11,27H,10H2,1H3,(H,23,24)/b17-16+ |
| InChIKey | CUKMGADBIGRWHM-WUKNDPDISA-N |
| XLogP | 4.03 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.90 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|