C12H13ClN4O2S — CID 47169106
2-[[4-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-methoxy-N-methylacetamide (PubChem CID 47169106) has the molecular formula C12H13ClN4O2S and a molecular weight of 312.78 g/mol. Its IUPAC name is 2-[[4-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-methoxy-N-methylacetamide.
| Compound Name | 2-[[4-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-methoxy-N-methylacetamide |
|---|---|
| PubChem CID | 47169106 |
| Molecular Formula | C12H13ClN4O2S |
| Molecular Weight | 312.78 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 2-[[4-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-methoxy-N-methylacetamide |
| SMILES | CON(C)C(=O)CSc1nncn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C12H13ClN4O2S/c1-16(19-2)11(18)7-20-12-15-14-8-17(12)10-5-3-4-9(13)6-10/h3-6,8H,7H2,1-2H3 |
| InChIKey | OPLVXJHMTVLASV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.78 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|