C18H14ClN3O3S — CID 87011725
(3-acetylphenyl) 2-[[4-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetate (PubChem CID 87011725) has the molecular formula C18H14ClN3O3S and a molecular weight of 387.85 g/mol. Its IUPAC name is (3-acetylphenyl) 2-[[4-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetate.
| Compound Name | (3-acetylphenyl) 2-[[4-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 87011725 |
| Molecular Formula | C18H14ClN3O3S |
| Molecular Weight | 387.85 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | (3-acetylphenyl) 2-[[4-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetate |
| SMILES | CC(=O)c1cccc(OC(=O)CSc2nncn2-c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C18H14ClN3O3S/c1-12(23)13-4-2-7-16(8-13)25-17(24)10-26-18-21-20-11-22(18)15-6-3-5-14(19)9-15/h2-9,11H,10H2,1H3 |
| InChIKey | YUBVUDCSIVXADM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.85 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|