C24H23N5O7S2 — CID 136877544
methyl 2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[[5-(3-morpholin-4-ylsulfonylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]but-2-enoate (PubChem CID 136877544) has the molecular formula C24H23N5O7S2 and a molecular weight of 557.61 g/mol. Its IUPAC name is methyl 2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[[5-(3-morpholin-4-ylsulfonylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]but-2-enoate.
| Compound Name | methyl 2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[[5-(3-morpholin-4-ylsulfonylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]but-2-enoate |
|---|---|
| PubChem CID | 136877544 |
| Molecular Formula | C24H23N5O7S2 |
| Molecular Weight | 557.61 g/mol |
| Exact Mass | 557.10 |
| IUPAC Name | methyl 2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[[5-(3-morpholin-4-ylsulfonylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]but-2-enoate |
| SMILES | COC(=O)C(=C(O)CSc1nnc(-c2cccc(S(=O)(=O)N3CCOCC3)c2)o1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C24H23N5O7S2/c1-34-23(31)20(21-25-17-7-2-3-8-18(17)26-21)19(30)14-37-24-28-27-22(36-24)15-5-4-6-16(13-15)38(32,33)29-9-11-35-12-10-29/h2-8,13,30H,9-12,14H2,1H3,(H,25,26) |
| InChIKey | VAXJDUVYNANENF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 160.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.61 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|