C18H13ClN4O3 — CID 87745319
3-(3H-benzimidazol-5-ylamino)-4-[(2-chloro-3-hydroxyphenyl)methylamino]cyclobut-3-ene-1,2-dione (PubChem CID 87745319) has the molecular formula C18H13ClN4O3 and a molecular weight of 368.78 g/mol. Its IUPAC name is 3-(3H-benzimidazol-5-ylamino)-4-[(2-chloro-3-hydroxyphenyl)methylamino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(3H-benzimidazol-5-ylamino)-4-[(2-chloro-3-hydroxyphenyl)methylamino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 87745319 |
| Molecular Formula | C18H13ClN4O3 |
| Molecular Weight | 368.78 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 3-(3H-benzimidazol-5-ylamino)-4-[(2-chloro-3-hydroxyphenyl)methylamino]cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(NCc2cccc(O)c2Cl)c(Nc2ccc3nc[nH]c3c2)c1=O |
| InChI | InChI=1S/C18H13ClN4O3/c19-14-9(2-1-3-13(14)24)7-20-15-16(18(26)17(15)25)23-10-4-5-11-12(6-10)22-8-21-11/h1-6,8,20,23-24H,7H2,(H,21,22) |
| InChIKey | BHPUTFVJMJWGND-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.78 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|