C14H10ClN3O2 — CID 64788874
N-(3-chloro-4-hydroxyphenyl)-3H-benzimidazole-5-carboxamide (PubChem CID 64788874) has the molecular formula C14H10ClN3O2 and a molecular weight of 287.71 g/mol. Its IUPAC name is N-(3-chloro-4-hydroxyphenyl)-3H-benzimidazole-5-carboxamide.
| Compound Name | N-(3-chloro-4-hydroxyphenyl)-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 64788874 |
| Molecular Formula | C14H10ClN3O2 |
| Molecular Weight | 287.71 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | N-(3-chloro-4-hydroxyphenyl)-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(Nc1ccc(O)c(Cl)c1)c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C14H10ClN3O2/c15-10-6-9(2-4-13(10)19)18-14(20)8-1-3-11-12(5-8)17-7-16-11/h1-7,19H,(H,16,17)(H,18,20) |
| InChIKey | ZMJFCXLQPLTPEF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.71 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|