C28H21N7O2 — CID 67686736
N-[4-[4-(3H-benzimidazole-5-carbonylamino)anilino]phenyl]-3H-benzimidazole-5-carboxamide (PubChem CID 67686736) has the molecular formula C28H21N7O2 and a molecular weight of 487.52 g/mol. Its IUPAC name is N-[4-[4-(3H-benzimidazole-5-carbonylamino)anilino]phenyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[4-[4-(3H-benzimidazole-5-carbonylamino)anilino]phenyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 67686736 |
| Molecular Formula | C28H21N7O2 |
| Molecular Weight | 487.52 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | N-[4-[4-(3H-benzimidazole-5-carbonylamino)anilino]phenyl]-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(Nc1ccc(Nc2ccc(NC(=O)c3ccc4nc[nH]c4c3)cc2)cc1)c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C28H21N7O2/c36-27(17-1-11-23-25(13-17)31-15-29-23)34-21-7-3-19(4-8-21)33-20-5-9-22(10-6-20)35-28(37)18-2-12-24-26(14-18)32-16-30-24/h1-16,33H,(H,29,31)(H,30,32)(H,34,36)(H,35,37) |
| InChIKey | NFODDOAOQCJEFO-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.52 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |