C22H21N5O — CID 67113871
N-[4-[4-(dimethylamino)anilino]phenyl]-3H-benzimidazole-5-carboxamide (PubChem CID 67113871) has the molecular formula C22H21N5O and a molecular weight of 371.44 g/mol. Its IUPAC name is N-[4-[4-(dimethylamino)anilino]phenyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[4-[4-(dimethylamino)anilino]phenyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 67113871 |
| Molecular Formula | C22H21N5O |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | N-[4-[4-(dimethylamino)anilino]phenyl]-3H-benzimidazole-5-carboxamide |
| SMILES | CN(C)c1ccc(Nc2ccc(NC(=O)c3ccc4nc[nH]c4c3)cc2)cc1 |
| InChI | InChI=1S/C22H21N5O/c1-27(2)19-10-8-17(9-11-19)25-16-4-6-18(7-5-16)26-22(28)15-3-12-20-21(13-15)24-14-23-20/h3-14,25H,1-2H3,(H,23,24)(H,26,28) |
| InChIKey | OVZMRVPAGPUXHC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|